C20H28F5KO2S — CID 162744236
potassium 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-olate (PubChem CID 162744236) has the molecular formula C20H28F5KO2S and a molecular weight of 466.60 g/mol. Its IUPAC name is potassium 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-olate.
| Compound Name | potassium 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-olate |
|---|---|
| PubChem CID | 162744236 |
| Molecular Formula | C20H28F5KO2S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | potassium 3-[11-[4-(pentafluoro-λ6-sulfanyl)phenyl]undec-10-ynoxy]propan-1-olate |
| SMILES | [K+].[O-]CCCOCCCCCCCCCC#Cc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C20H28F5O2S.K/c21-28(22,23,24,25)20-14-12-19(13-15-20)11-8-6-4-2-1-3-5-7-9-17-27-18-10-16-26;/h12-15H,1-7,9-10,16-18H2;/q-1;+1 |
| InChIKey | JFHCZZKAMKGFEI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|