C23H35F5O2S — CID 170689143
pentafluoro-[4-[11-(3-propan-2-yloxypropoxy)undec-1-ynyl]phenyl]-λ6-sulfane (PubChem CID 170689143) has the molecular formula C23H35F5O2S and a molecular weight of 470.59 g/mol. Its IUPAC name is pentafluoro-[4-[11-(3-propan-2-yloxypropoxy)undec-1-ynyl]phenyl]-λ6-sulfane.
| Compound Name | pentafluoro-[4-[11-(3-propan-2-yloxypropoxy)undec-1-ynyl]phenyl]-λ6-sulfane |
|---|---|
| PubChem CID | 170689143 |
| Molecular Formula | C23H35F5O2S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | pentafluoro-[4-[11-(3-propan-2-yloxypropoxy)undec-1-ynyl]phenyl]-λ6-sulfane |
| SMILES | CC(C)OCCCOCCCCCCCCCC#Cc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C23H35F5O2S/c1-21(2)30-20-12-19-29-18-11-9-7-5-3-4-6-8-10-13-22-14-16-23(17-15-22)31(24,25,26,27)28/h14-17,21H,3-9,11-12,18-20H2,1-2H3 |
| InChIKey | ZCYQYMPEJYDLOL-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|