C25H40O2 — CID 162744345
1-(3,3-dimethylbut-1-ynyl)-4-[8-(3-ethoxypropoxy)octyl]benzene (PubChem CID 162744345) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is 1-(3,3-dimethylbut-1-ynyl)-4-[8-(3-ethoxypropoxy)octyl]benzene.
| Compound Name | 1-(3,3-dimethylbut-1-ynyl)-4-[8-(3-ethoxypropoxy)octyl]benzene |
|---|---|
| PubChem CID | 162744345 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | 1-(3,3-dimethylbut-1-ynyl)-4-[8-(3-ethoxypropoxy)octyl]benzene |
| SMILES | CCOCCCOCCCCCCCCc1ccc(C#CC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H40O2/c1-5-26-21-12-22-27-20-11-9-7-6-8-10-13-23-14-16-24(17-15-23)18-19-25(2,3)4/h14-17H,5-13,20-22H2,1-4H3 |
| InChIKey | ARHPESDCRMHYJC-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|