C25H42O2Si — CID 170688801
trimethyl-[2-[4-[9-(2-propan-2-yloxyethoxy)nonyl]phenyl]ethynyl]silane (PubChem CID 170688801) has the molecular formula C25H42O2Si and a molecular weight of 402.70 g/mol. Its IUPAC name is trimethyl-[2-[4-[9-(2-propan-2-yloxyethoxy)nonyl]phenyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[4-[9-(2-propan-2-yloxyethoxy)nonyl]phenyl]ethynyl]silane |
|---|---|
| PubChem CID | 170688801 |
| Molecular Formula | C25H42O2Si |
| Molecular Weight | 402.70 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | trimethyl-[2-[4-[9-(2-propan-2-yloxyethoxy)nonyl]phenyl]ethynyl]silane |
| SMILES | CC(C)OCCOCCCCCCCCCc1ccc(C#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C25H42O2Si/c1-23(2)27-21-20-26-19-12-10-8-6-7-9-11-13-24-14-16-25(17-15-24)18-22-28(3,4)5/h14-17,23H,6-13,19-21H2,1-5H3 |
| InChIKey | WIRQCEKFQTWSNN-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.70 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|