C16H20N2OS2 — CID 162745422
ethenethiol;2-ethyl-1,3-benzothiazole;5-ethyl-1,3-oxazole (PubChem CID 162745422) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is ethenethiol;2-ethyl-1,3-benzothiazole;5-ethyl-1,3-oxazole.
| Compound Name | ethenethiol;2-ethyl-1,3-benzothiazole;5-ethyl-1,3-oxazole |
|---|---|
| PubChem CID | 162745422 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | ethenethiol;2-ethyl-1,3-benzothiazole;5-ethyl-1,3-oxazole |
| SMILES | C=CS.CCc1cnco1.CCc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H9NS.C5H7NO.C2H4S/c1-2-9-10-7-5-3-4-6-8(7)11-9;1-2-5-3-6-4-7-5;1-2-3/h3-6H,2H2,1H3;3-4H,2H2,1H3;2-3H,1H2 |
| InChIKey | QGFOLUITVLAPPX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 38.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|