C22H34N6O3 — CID 162747706
(2R,4R)-4-hydrazinyl-1-[(2R)-2-[[(2R)-2-(methylamino)propanoyl]amino]propanoyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide (PubChem CID 162747706) has the molecular formula C22H34N6O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is (2R,4R)-4-hydrazinyl-1-[(2R)-2-[[(2R)-2-(methylamino)propanoyl]amino]propanoyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-4-hydrazinyl-1-[(2R)-2-[[(2R)-2-(methylamino)propanoyl]amino]propanoyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 162747706 |
| Molecular Formula | C22H34N6O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (2R,4R)-4-hydrazinyl-1-[(2R)-2-[[(2R)-2-(methylamino)propanoyl]amino]propanoyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolidine-2-carboxamide |
| SMILES | CN[C@H](C)C(=O)N[C@H](C)C(=O)N1C[C@H](NN)C[C@@H]1C(=O)N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C22H34N6O3/c1-13(24-3)20(29)25-14(2)22(31)28-12-16(27-23)11-19(28)21(30)26-18-10-6-8-15-7-4-5-9-17(15)18/h4-5,7,9,13-14,16,18-19,24,27H,6,8,10-12,23H2,1-3H3,(H,25,29)(H,26,30)/t13-,14-,16-,18+,19-/m1/s1 |
| InChIKey | OETTWXAZFYWGNT-FRFIEDCNSA-N |
| XLogP | -0.27 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|