C18H16ClNO4 — CID 162748292
(E)-N-(1,3-benzodioxol-5-yl)-3-(4-chloro-2-ethoxyphenyl)prop-2-enamide (PubChem CID 162748292) has the molecular formula C18H16ClNO4 and a molecular weight of 345.78 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-yl)-3-(4-chloro-2-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-yl)-3-(4-chloro-2-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 162748292 |
| Molecular Formula | C18H16ClNO4 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-yl)-3-(4-chloro-2-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1cc(Cl)ccc1/C=C/C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H16ClNO4/c1-2-22-16-9-13(19)5-3-12(16)4-8-18(21)20-14-6-7-15-17(10-14)24-11-23-15/h3-10H,2,11H2,1H3,(H,20,21)/b8-4+ |
| InChIKey | VXDSOSPXHOQOOO-XBXARRHUSA-N |
| XLogP | 4.12 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|