C23H27Cl2N5O3 — CID 162750984
7,8-dichloro-4-(1H-pyrazol-4-yl)-2-pyrrolidin-1-ylquinoline;formic acid;1-pyrrolidin-1-ylethanone (PubChem CID 162750984) has the molecular formula C23H27Cl2N5O3 and a molecular weight of 492.41 g/mol. Its IUPAC name is 7,8-dichloro-4-(1H-pyrazol-4-yl)-2-pyrrolidin-1-ylquinoline;formic acid;1-pyrrolidin-1-ylethanone.
| Compound Name | 7,8-dichloro-4-(1H-pyrazol-4-yl)-2-pyrrolidin-1-ylquinoline;formic acid;1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 162750984 |
| Molecular Formula | C23H27Cl2N5O3 |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 7,8-dichloro-4-(1H-pyrazol-4-yl)-2-pyrrolidin-1-ylquinoline;formic acid;1-pyrrolidin-1-ylethanone |
| SMILES | CC(=O)N1CCCC1.Clc1ccc2c(-c3cn[nH]c3)cc(N3CCCC3)nc2c1Cl.O=CO |
| InChI | InChI=1S/C16H14Cl2N4.C6H11NO.CH2O2/c17-13-4-3-11-12(10-8-19-20-9-10)7-14(21-16(11)15(13)18)22-5-1-2-6-22;1-6(8)7-4-2-3-5-7;2-1-3/h3-4,7-9H,1-2,5-6H2,(H,19,20);2-5H2,1H3;1H,(H,2,3) |
| InChIKey | PTWXXUNALDAMGV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|