C11H24N2O4S — CID 162751325
ethane;3-[2-(methylamino)ethylsulfonylamino]cyclopentane-1-carboxylic acid (PubChem CID 162751325) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is ethane;3-[2-(methylamino)ethylsulfonylamino]cyclopentane-1-carboxylic acid.
| Compound Name | ethane;3-[2-(methylamino)ethylsulfonylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 162751325 |
| Molecular Formula | C11H24N2O4S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | ethane;3-[2-(methylamino)ethylsulfonylamino]cyclopentane-1-carboxylic acid |
| SMILES | CC.CNCCS(=O)(=O)NC1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C9H18N2O4S.C2H6/c1-10-4-5-16(14,15)11-8-3-2-7(6-8)9(12)13;1-2/h7-8,10-11H,2-6H2,1H3,(H,12,13);1-2H3 |
| InChIKey | RKKFPUWZZCEABG-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |