C29H31F2N7O6 — CID 162752166
4-[3-[4-carboxy-2-fluoro-5-(2-methylidenebut-3-enoylamino)phenyl]propyl]-5-fluoro-2-[(1-hydrazinyl-6-iminopyridazine-3-carbonyl)amino]benzoic acid;ethane (PubChem CID 162752166) has the molecular formula C29H31F2N7O6 and a molecular weight of 611.61 g/mol. Its IUPAC name is 4-[3-[4-carboxy-2-fluoro-5-(2-methylidenebut-3-enoylamino)phenyl]propyl]-5-fluoro-2-[(1-hydrazinyl-6-iminopyridazine-3-carbonyl)amino]benzoic acid;ethane.
| Compound Name | 4-[3-[4-carboxy-2-fluoro-5-(2-methylidenebut-3-enoylamino)phenyl]propyl]-5-fluoro-2-[(1-hydrazinyl-6-iminopyridazine-3-carbonyl)amino]benzoic acid;ethane |
|---|---|
| PubChem CID | 162752166 |
| Molecular Formula | C29H31F2N7O6 |
| Molecular Weight | 611.61 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | 4-[3-[4-carboxy-2-fluoro-5-(2-methylidenebut-3-enoylamino)phenyl]propyl]-5-fluoro-2-[(1-hydrazinyl-6-iminopyridazine-3-carbonyl)amino]benzoic acid;ethane |
| SMILES | CC.[H]/N=c1\ccc(C(=O)Nc2cc(CCCc3cc(NC(=O)C(=C)C=C)c(C(=O)O)cc3F)c(F)cc2C(=O)O)nn1NN |
| InChI | InChI=1S/C27H25F2N7O6.C2H6/c1-3-13(2)24(37)32-21-9-14(18(28)11-16(21)26(39)40)5-4-6-15-10-22(17(27(41)42)12-19(15)29)33-25(38)20-7-8-23(30)36(34-20)35-31;1-2/h3,7-12,30,35H,1-2,4-6,31H2,(H,32,37)(H,33,38)(H,39,40)(H,41,42);1-2H3/b30-23+; |
| InChIKey | IZYAGCGSTAZLDF-LMRTZVMQSA-N |
| XLogP | 3.59 |
| TPSA | 212.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|