C30H32N4O8 — CID 162752147
4-[4-[4-carboxy-3-(2-methylidenebut-3-enoylamino)phenoxy]butoxy]-2-(pyridazine-3-carbonylamino)benzoic acid;ethane (PubChem CID 162752147) has the molecular formula C30H32N4O8 and a molecular weight of 576.61 g/mol. Its IUPAC name is 4-[4-[4-carboxy-3-(2-methylidenebut-3-enoylamino)phenoxy]butoxy]-2-(pyridazine-3-carbonylamino)benzoic acid;ethane.
| Compound Name | 4-[4-[4-carboxy-3-(2-methylidenebut-3-enoylamino)phenoxy]butoxy]-2-(pyridazine-3-carbonylamino)benzoic acid;ethane |
|---|---|
| PubChem CID | 162752147 |
| Molecular Formula | C30H32N4O8 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | 4-[4-[4-carboxy-3-(2-methylidenebut-3-enoylamino)phenoxy]butoxy]-2-(pyridazine-3-carbonylamino)benzoic acid;ethane |
| SMILES | C=CC(=C)C(=O)Nc1cc(OCCCCOc2ccc(C(=O)O)c(NC(=O)c3cccnn3)c2)ccc1C(=O)O.CC |
| InChI | InChI=1S/C28H26N4O8.C2H6/c1-3-17(2)25(33)30-23-15-18(8-10-20(23)27(35)36)39-13-4-5-14-40-19-9-11-21(28(37)38)24(16-19)31-26(34)22-7-6-12-29-32-22;1-2/h3,6-12,15-16H,1-2,4-5,13-14H2,(H,30,33)(H,31,34)(H,35,36)(H,37,38);1-2H3 |
| InChIKey | UDPIPHLRNSDEPT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 177.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|