C27H32ClN5O8 — CID 162752399
methyl 2-[(2-aminoacetyl)amino]-4-[4-[3-[[(2Z,4E)-2,5-diamino-5-chloropenta-2,4-dienoyl]amino]-4-methoxycarbonylphenoxy]butoxy]benzoate (PubChem CID 162752399) has the molecular formula C27H32ClN5O8 and a molecular weight of 590.03 g/mol. Its IUPAC name is methyl 2-[(2-aminoacetyl)amino]-4-[4-[3-[[(2Z,4E)-2,5-diamino-5-chloropenta-2,4-dienoyl]amino]-4-methoxycarbonylphenoxy]butoxy]benzoate.
| Compound Name | methyl 2-[(2-aminoacetyl)amino]-4-[4-[3-[[(2Z,4E)-2,5-diamino-5-chloropenta-2,4-dienoyl]amino]-4-methoxycarbonylphenoxy]butoxy]benzoate |
|---|---|
| PubChem CID | 162752399 |
| Molecular Formula | C27H32ClN5O8 |
| Molecular Weight | 590.03 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | methyl 2-[(2-aminoacetyl)amino]-4-[4-[3-[[(2Z,4E)-2,5-diamino-5-chloropenta-2,4-dienoyl]amino]-4-methoxycarbonylphenoxy]butoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCCCOc2ccc(C(=O)OC)c(NC(=O)/C(N)=C/C=C(\N)Cl)c2)cc1NC(=O)CN |
| InChI | InChI=1S/C27H32ClN5O8/c1-38-26(36)18-7-5-16(13-21(18)32-24(34)15-29)40-11-3-4-12-41-17-6-8-19(27(37)39-2)22(14-17)33-25(35)20(30)9-10-23(28)31/h5-10,13-14H,3-4,11-12,15,29-31H2,1-2H3,(H,32,34)(H,33,35)/b20-9-,23-10- |
| InChIKey | VKJGWQPFHJBSSU-BRKWTKDHSA-N |
| XLogP | 2.21 |
| TPSA | 207.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.03 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|