C21H24N2O3 — CID 162752472
ethyl 1-(1-cyanocyclobutyl)-5-(oxan-4-yl)indole-2-carboxylate (PubChem CID 162752472) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is ethyl 1-(1-cyanocyclobutyl)-5-(oxan-4-yl)indole-2-carboxylate.
| Compound Name | ethyl 1-(1-cyanocyclobutyl)-5-(oxan-4-yl)indole-2-carboxylate |
|---|---|
| PubChem CID | 162752472 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | ethyl 1-(1-cyanocyclobutyl)-5-(oxan-4-yl)indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(C3CCOCC3)ccc2n1C1(C#N)CCC1 |
| InChI | InChI=1S/C21H24N2O3/c1-2-26-20(24)19-13-17-12-16(15-6-10-25-11-7-15)4-5-18(17)23(19)21(14-22)8-3-9-21/h4-5,12-13,15H,2-3,6-11H2,1H3 |
| InChIKey | FELDANFIFMKYRK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |