C19H18N4O — CID 162755037
2-(10,11-dimethylpyrido[3,4-b]carbazol-7-yl)oxyethanimidamide (PubChem CID 162755037) has the molecular formula C19H18N4O and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-(10,11-dimethylpyrido[3,4-b]carbazol-7-yl)oxyethanimidamide.
| Compound Name | 2-(10,11-dimethylpyrido[3,4-b]carbazol-7-yl)oxyethanimidamide |
|---|---|
| PubChem CID | 162755037 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-(10,11-dimethylpyrido[3,4-b]carbazol-7-yl)oxyethanimidamide |
| SMILES | [H]/N=C(\N)COc1ccc2c(c1)c1cc3ccncc3c(C)c1n2C |
| InChI | InChI=1S/C19H18N4O/c1-11-16-9-22-6-5-12(16)7-15-14-8-13(24-10-18(20)21)3-4-17(14)23(2)19(11)15/h3-9H,10H2,1-2H3,(H3,20,21) |
| InChIKey | YZKMLMAOANXZOL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|