C22H18N4O — CID 162755193
4-(5,6-dimethylpyrido[4,3-b]carbazol-9-yl)oxypyridin-2-amine (PubChem CID 162755193) has the molecular formula C22H18N4O and a molecular weight of 354.41 g/mol. Its IUPAC name is 4-(5,6-dimethylpyrido[4,3-b]carbazol-9-yl)oxypyridin-2-amine.
| Compound Name | 4-(5,6-dimethylpyrido[4,3-b]carbazol-9-yl)oxypyridin-2-amine |
|---|---|
| PubChem CID | 162755193 |
| Molecular Formula | C22H18N4O |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 4-(5,6-dimethylpyrido[4,3-b]carbazol-9-yl)oxypyridin-2-amine |
| SMILES | Cc1c2ccncc2cc2c3cc(Oc4ccnc(N)c4)ccc3n(C)c12 |
| InChI | InChI=1S/C22H18N4O/c1-13-17-6-7-24-12-14(17)9-19-18-10-15(3-4-20(18)26(2)22(13)19)27-16-5-8-25-21(23)11-16/h3-12H,1-2H3,(H2,23,25) |
| InChIKey | SUUCHLNIHNFFMH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |