C22H25N3O — CID 162755230
3-(5,6-dimethylpyrido[3,4-h]carbazol-7-yl)oxy-N,N-dimethylpropan-1-amine (PubChem CID 162755230) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-(5,6-dimethylpyrido[3,4-h]carbazol-7-yl)oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(5,6-dimethylpyrido[3,4-h]carbazol-7-yl)oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 162755230 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 3-(5,6-dimethylpyrido[3,4-h]carbazol-7-yl)oxy-N,N-dimethylpropan-1-amine |
| SMILES | Cc1c2ccncc2cc2c3cccc(OCCCN(C)C)c3n(C)c12 |
| InChI | InChI=1S/C22H25N3O/c1-15-17-9-10-23-14-16(17)13-19-18-7-5-8-20(22(18)25(4)21(15)19)26-12-6-11-24(2)3/h5,7-10,13-14H,6,11-12H2,1-4H3 |
| InChIKey | RTKWSIGYIWPILS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|