C10H11NOS — CID 162757962
3-(2-methoxyphenyl)-2,3-dihydro-1,2-thiazole (PubChem CID 162757962) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-2,3-dihydro-1,2-thiazole.
| Compound Name | 3-(2-methoxyphenyl)-2,3-dihydro-1,2-thiazole |
|---|---|
| PubChem CID | 162757962 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 3-(2-methoxyphenyl)-2,3-dihydro-1,2-thiazole |
| SMILES | COc1ccccc1C1C=CSN1 |
| InChI | InChI=1S/C10H11NOS/c1-12-10-5-3-2-4-8(10)9-6-7-13-11-9/h2-7,9,11H,1H3 |
| InChIKey | AZNDJHJSFNGGNK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|