C16H13N5O — CID 162759536
2-amino-6-(4-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)imidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 162759536) has the molecular formula C16H13N5O and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-amino-6-(4-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)imidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 2-amino-6-(4-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)imidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 162759536 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-amino-6-(4-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)imidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | Cc1c(-c2ccc3nc(N)c(C=O)n3c2)cnc2[nH]ccc12 |
| InChI | InChI=1S/C16H13N5O/c1-9-11-4-5-18-16(11)19-6-12(9)10-2-3-14-20-15(17)13(8-22)21(14)7-10/h2-8H,17H2,1H3,(H,18,19) |
| InChIKey | GHUZAWIPHLVSFQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|