C18H18FN3O2 — CID 162759639
2-amino-6-[3-fluoro-2-(hydroxymethyl)phenyl]imidazo[1,2-a]pyridine-3-carbaldehyde;cyclopropane (PubChem CID 162759639) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-amino-6-[3-fluoro-2-(hydroxymethyl)phenyl]imidazo[1,2-a]pyridine-3-carbaldehyde;cyclopropane.
| Compound Name | 2-amino-6-[3-fluoro-2-(hydroxymethyl)phenyl]imidazo[1,2-a]pyridine-3-carbaldehyde;cyclopropane |
|---|---|
| PubChem CID | 162759639 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-amino-6-[3-fluoro-2-(hydroxymethyl)phenyl]imidazo[1,2-a]pyridine-3-carbaldehyde;cyclopropane |
| SMILES | C1CC1.Nc1nc2ccc(-c3cccc(F)c3CO)cn2c1C=O |
| InChI | InChI=1S/C15H12FN3O2.C3H6/c16-12-3-1-2-10(11(12)7-20)9-4-5-14-18-15(17)13(8-21)19(14)6-9;1-2-3-1/h1-6,8,20H,7,17H2;1-3H2 |
| InChIKey | DTYHZHYABXNUGO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|