C18H17F2N3O — CID 162759634
2-amino-8-fluoro-6-(3-fluoro-2-methylphenyl)imidazo[1,2-a]pyridine-3-carbaldehyde;cyclopropane (PubChem CID 162759634) has the molecular formula C18H17F2N3O and a molecular weight of 329.35 g/mol. Its IUPAC name is 2-amino-8-fluoro-6-(3-fluoro-2-methylphenyl)imidazo[1,2-a]pyridine-3-carbaldehyde;cyclopropane.
| Compound Name | 2-amino-8-fluoro-6-(3-fluoro-2-methylphenyl)imidazo[1,2-a]pyridine-3-carbaldehyde;cyclopropane |
|---|---|
| PubChem CID | 162759634 |
| Molecular Formula | C18H17F2N3O |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-amino-8-fluoro-6-(3-fluoro-2-methylphenyl)imidazo[1,2-a]pyridine-3-carbaldehyde;cyclopropane |
| SMILES | C1CC1.Cc1c(F)cccc1-c1cc(F)c2nc(N)c(C=O)n2c1 |
| InChI | InChI=1S/C15H11F2N3O.C3H6/c1-8-10(3-2-4-11(8)16)9-5-12(17)15-19-14(18)13(7-21)20(15)6-9;1-2-3-1/h2-7H,18H2,1H3;1-3H2 |
| InChIKey | OATVQJKRVCGAKF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|