C25H33N5O2 — CID 162759663
N-[2,6-diethyl-7-(3-piperidin-1-ylpropylamino)-[1,3]oxazolo[4,5-b]pyridin-5-yl]benzamide (PubChem CID 162759663) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-[2,6-diethyl-7-(3-piperidin-1-ylpropylamino)-[1,3]oxazolo[4,5-b]pyridin-5-yl]benzamide.
| Compound Name | N-[2,6-diethyl-7-(3-piperidin-1-ylpropylamino)-[1,3]oxazolo[4,5-b]pyridin-5-yl]benzamide |
|---|---|
| PubChem CID | 162759663 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | N-[2,6-diethyl-7-(3-piperidin-1-ylpropylamino)-[1,3]oxazolo[4,5-b]pyridin-5-yl]benzamide |
| SMILES | CCc1nc2nc(NC(=O)c3ccccc3)c(CC)c(NCCCN3CCCCC3)c2o1 |
| InChI | InChI=1S/C25H33N5O2/c1-3-19-21(26-14-11-17-30-15-9-6-10-16-30)22-24(27-20(4-2)32-22)28-23(19)29-25(31)18-12-7-5-8-13-18/h5,7-8,12-13H,3-4,6,9-11,14-17H2,1-2H3,(H2,26,28,29,31) |
| InChIKey | SQZKIWUXXJMFIL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|