C12H19NO2S — CID 162759779
ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 162759779) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one.
| Compound Name | ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 162759779 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | CC.CC.Cc1cc2[nH]c(=O)cc(O)c2s1 |
| InChI | InChI=1S/C8H7NO2S.2C2H6/c1-4-2-5-8(12-4)6(10)3-7(11)9-5;2*1-2/h2-3H,1H3,(H2,9,10,11);2*1-2H3 |
| InChIKey | DSMZYFIBUQIWDP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |