About ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one
ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 162759779) has the molecular formula C12H19NO2S
and a molecular weight of 241.36 g/mol. Its IUPAC name is ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one.
Molecular Properties
| Compound Name | ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one |
| PubChem CID | 162759779 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | CC.CC.Cc1cc2[nH]c(=O)cc(O)c2s1 |
| InChI | InChI=1S/C8H7NO2S.2C2H6/c1-4-2-5-8(12-4)6(10)3-7(11)9-5;2*1-2/h2-3H,1H3,(H2,9,10,11);2*1-2H3 |
| InChIKey | DSMZYFIBUQIWDP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one?
The IUPAC name of ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one (CID 162759779) is ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one.
What is the SMILES notation for ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one?
The canonical SMILES for ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one is CC.CC.Cc1cc2[nH]c(=O)cc(O)c2s1.
What is the InChIKey of ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one?
The InChIKey is DSMZYFIBUQIWDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2S.2C2H6/c1-4-2-5-8(12-4)6(10)3-7(11)9-5;2*1-2/h2-3H,1H3,(H2,9,10,11);2*1-2H3.
What are the key properties of ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one?
ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one has a molecular weight of 241.36 g/mol, XLogP of 3.66, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-hydroxy-2-methyl-4H-thieno[3,2-b]pyridin-5-one is sourced from PubChem (CID 162759779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).