C20H17F3N6O — CID 162760335
3-[6-(difluoromethyl)-1H-pyrazolo[5,4-b]pyridin-4-yl]-2-(5-fluoro-2-pyridinyl)-6,6-bis(trideuteriomethyl)-4,7-dihydropyrazolo[5,1-c][1,4]oxazine (PubChem CID 162760335) has the molecular formula C20H17F3N6O and a molecular weight of 420.43 g/mol. Its IUPAC name is 3-[6-(difluoromethyl)-1H-pyrazolo[5,4-b]pyridin-4-yl]-2-(5-fluoro-2-pyridinyl)-6,6-bis(trideuteriomethyl)-4,7-dihydropyrazolo[5,1-c][1,4]oxazine.
| Compound Name | 3-[6-(difluoromethyl)-1H-pyrazolo[5,4-b]pyridin-4-yl]-2-(5-fluoro-2-pyridinyl)-6,6-bis(trideuteriomethyl)-4,7-dihydropyrazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 162760335 |
| Molecular Formula | C20H17F3N6O |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 3-[6-(difluoromethyl)-1H-pyrazolo[5,4-b]pyridin-4-yl]-2-(5-fluoro-2-pyridinyl)-6,6-bis(trideuteriomethyl)-4,7-dihydropyrazolo[5,1-c][1,4]oxazine |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])Cn2nc(-c3ccc(F)cn3)c(-c3cc(C(F)F)nc4[nH]ncc34)c2CO1 |
| InChI | InChI=1S/C20H17F3N6O/c1-20(2)9-29-15(8-30-20)16(17(28-29)13-4-3-10(21)6-24-13)11-5-14(18(22)23)26-19-12(11)7-25-27-19/h3-7,18H,8-9H2,1-2H3,(H,25,26,27)/i1D3,2D3 |
| InChIKey | BFQWJXDJEOGTQA-WFGJKAKNSA-N |
| XLogP | 4.27 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |