C11H18N2O2 — CID 162763545
9-acetyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 162763545) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 9-acetyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one.
| Compound Name | 9-acetyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 162763545 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 9-acetyl-2-methyl-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | CC(=O)N1CCCC2(CCN(C)C2=O)C1 |
| InChI | InChI=1S/C11H18N2O2/c1-9(14)13-6-3-4-11(8-13)5-7-12(2)10(11)15/h3-8H2,1-2H3 |
| InChIKey | MDSIJJLVPOQGMY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |