C50H61F3N6O8SSi — CID 162763584
CID 162763584 (PubChem CID 162763584) has the molecular formula C50H61F3N6O8SSi and a molecular weight of 991.22 g/mol.
| Compound Name | CID 162763584 |
|---|---|
| PubChem CID | 162763584 |
| Molecular Formula | C50H61F3N6O8SSi |
| Molecular Weight | 991.22 g/mol |
| Exact Mass | 990.40 |
| IUPAC Name | — |
| SMILES | CCn1c(-c2cccnc2C(OC)C2CS2)c2c3cc(ccc31)-c1cc(O)cc(c1)C[C@H](NC(=O)[C@H](C(C)C)N(C)C(=O)C1CCC(C(F)(F)F)O1)C(=O)N1CCC[C@H]([Si]N1)C(=O)OCC(C)(C)C2 |
| InChI | InChI=1S/C50H61F3N6O8SSi/c1-8-58-36-14-13-29-23-33(36)34(43(58)32-11-9-17-54-41(32)44(65-7)38-25-68-38)24-49(4,5)26-66-48(64)39-12-10-18-59(56-69-39)46(62)35(21-28-19-30(29)22-31(60)20-28)55-45(61)42(27(2)3)57(6)47(63)37-15-16-40(67-37)50(51,52)53/h9,11,13-14,17,19-20,22-23,27,35,37-40,42,44,56,60H,8,10,12,15-16,18,21,24-26H2,1-7H3,(H,55,61)/t35-,37?,38?,39-,40?,42-,44?/m0/s1 |
| InChIKey | KYOMLBYZQGVGOW-VLKYVJNWSA-N |
| XLogP | 7.18 |
| TPSA | 164.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.22 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|