C53H64N6O8SSi — CID 165407306
CID 165407306 (PubChem CID 165407306) has the molecular formula C53H64N6O8SSi and a molecular weight of 973.28 g/mol.
| Compound Name | CID 165407306 |
|---|---|
| PubChem CID | 165407306 |
| Molecular Formula | C53H64N6O8SSi |
| Molecular Weight | 973.28 g/mol |
| Exact Mass | 972.43 |
| IUPAC Name | — |
| SMILES | CCn1c(-c2cccnc2C(S)OC)c2c3cc(ccc31)-c1cc(O)cc(c1)C[C@H](NC(=O)[C@H](C(C)C)N(C)C(=O)[C@@H]1OCC[C@@H]1c1ccccc1)C(=O)N1CCC[C@H]([Si]N1)C(=O)OCC(C)(C)C2 |
| InChI | InChI=1S/C53H64N6O8SSi/c1-8-58-42-19-18-34-28-39(42)40(46(58)38-16-12-21-54-44(38)52(68)65-7)29-53(4,5)30-67-51(64)43-17-13-22-59(56-69-43)49(62)41(26-32-24-35(34)27-36(60)25-32)55-48(61)45(31(2)3)57(6)50(63)47-37(20-23-66-47)33-14-10-9-11-15-33/h9-12,14-16,18-19,21,24-25,27-28,31,37,41,43,45,47,52,56,60,68H,8,13,17,20,22-23,26,29-30H2,1-7H3,(H,55,61)/t37-,41+,43+,45+,47-,52?/m1/s1 |
| InChIKey | HBWVFMYBOUWLGU-PNHZUIEVSA-N |
| XLogP | 7.41 |
| TPSA | 164.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.28 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|