C19H15ClF6N4O2 — CID 162763693
N-(2-amino-3,3,3-trifluoropropyl)-6-chloro-8-[2-(2,2,2-trifluoroethoxy)phenyl]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 162763693) has the molecular formula C19H15ClF6N4O2 and a molecular weight of 480.80 g/mol. Its IUPAC name is N-(2-amino-3,3,3-trifluoropropyl)-6-chloro-8-[2-(2,2,2-trifluoroethoxy)phenyl]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-(2-amino-3,3,3-trifluoropropyl)-6-chloro-8-[2-(2,2,2-trifluoroethoxy)phenyl]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162763693 |
| Molecular Formula | C19H15ClF6N4O2 |
| Molecular Weight | 480.80 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | N-(2-amino-3,3,3-trifluoropropyl)-6-chloro-8-[2-(2,2,2-trifluoroethoxy)phenyl]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | NC(CNC(=O)c1cn2cc(Cl)cc(-c3ccccc3OCC(F)(F)F)c2n1)C(F)(F)F |
| InChI | InChI=1S/C19H15ClF6N4O2/c20-10-5-12(11-3-1-2-4-14(11)32-9-18(21,22)23)16-29-13(8-30(16)7-10)17(31)28-6-15(27)19(24,25)26/h1-5,7-8,15H,6,9,27H2,(H,28,31) |
| InChIKey | BRBSRDQKXDHLMK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.80 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |