C15H27N3O4S — CID 162769150
tert-butyl (NZ)-N-[(6-acetamidohexanoylamino)-methylsulfanylmethylidene]carbamate (PubChem CID 162769150) has the molecular formula C15H27N3O4S and a molecular weight of 345.47 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[(6-acetamidohexanoylamino)-methylsulfanylmethylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[(6-acetamidohexanoylamino)-methylsulfanylmethylidene]carbamate |
|---|---|
| PubChem CID | 162769150 |
| Molecular Formula | C15H27N3O4S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | tert-butyl (NZ)-N-[(6-acetamidohexanoylamino)-methylsulfanylmethylidene]carbamate |
| SMILES | CS/C(=N\C(=O)OC(C)(C)C)NC(=O)CCCCCNC(C)=O |
| InChI | InChI=1S/C15H27N3O4S/c1-11(19)16-10-8-6-7-9-12(20)17-13(23-5)18-14(21)22-15(2,3)4/h6-10H2,1-5H3,(H,16,19)(H,17,18,20,21) |
| InChIKey | MILKDIINWRDRHE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|