C52H32N6O — CID 162774872
12-[7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]-6-(4-phenylphenyl)-8-oxa-3,5,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene (PubChem CID 162774872) has the molecular formula C52H32N6O and a molecular weight of 756.87 g/mol. Its IUPAC name is 12-[7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]-6-(4-phenylphenyl)-8-oxa-3,5,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene.
| Compound Name | 12-[7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]-6-(4-phenylphenyl)-8-oxa-3,5,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
|---|---|
| PubChem CID | 162774872 |
| Molecular Formula | C52H32N6O |
| Molecular Weight | 756.87 g/mol |
| Exact Mass | 756.26 |
| IUPAC Name | 12-[7-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]-6-(4-phenylphenyl)-8-oxa-3,5,11-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
| SMILES | c1ccc(-c2ccc(-c3ncnc4c3oc3cnc(-c5ccc6ccc(-c7ccc(-c8nc(-c9ccccc9)nc(-c9ccccc9)n8)cc7)cc6c5)cc34)cc2)cc1 |
| InChI | InChI=1S/C52H32N6O/c1-4-10-33(11-5-1)34-16-22-37(23-17-34)47-49-48(55-32-54-47)44-30-45(53-31-46(44)59-49)42-27-21-36-20-26-41(28-43(36)29-42)35-18-24-40(25-19-35)52-57-50(38-12-6-2-7-13-38)56-51(58-52)39-14-8-3-9-15-39/h1-32H |
| InChIKey | BJJHJCXYLOSDHT-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.87 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |