C50H30N6S — CID 162775070
4-anthracen-2-yl-12-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 162775070) has the molecular formula C50H30N6S and a molecular weight of 746.90 g/mol. Its IUPAC name is 4-anthracen-2-yl-12-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 4-anthracen-2-yl-12-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 162775070 |
| Molecular Formula | C50H30N6S |
| Molecular Weight | 746.90 g/mol |
| Exact Mass | 746.23 |
| IUPAC Name | 4-anthracen-2-yl-12-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5cnc6sc7cnc(-c8ccc9cc%10ccccc%10cc9c8)nc7c6c5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C50H30N6S/c1-3-9-31(10-4-1)32-15-19-35(20-16-32)48-54-47(34-11-5-2-6-12-34)55-49(56-48)36-21-17-33(18-22-36)42-28-43-45-44(57-50(43)52-29-42)30-51-46(53-45)40-24-23-39-25-37-13-7-8-14-38(37)26-41(39)27-40/h1-30H |
| InChIKey | XWBCEIDMCDYVBF-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.90 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|