C51H31N5O — CID 162774744
4-anthracen-2-yl-12-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 162774744) has the molecular formula C51H31N5O and a molecular weight of 729.84 g/mol. Its IUPAC name is 4-anthracen-2-yl-12-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 4-anthracen-2-yl-12-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 162774744 |
| Molecular Formula | C51H31N5O |
| Molecular Weight | 729.84 g/mol |
| Exact Mass | 729.25 |
| IUPAC Name | 4-anthracen-2-yl-12-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccc(-c5cnc6oc7cnc(-c8ccc9cc%10ccccc%10cc9c8)nc7c6c5)cc4)nc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C51H31N5O/c1-3-9-32(10-4-1)33-15-19-35(20-16-33)45-29-46(55-50(54-45)37-11-5-2-6-12-37)36-21-17-34(18-22-36)43-28-44-48-47(57-51(44)53-30-43)31-52-49(56-48)41-24-23-40-25-38-13-7-8-14-39(38)26-42(40)27-41/h1-31H |
| InChIKey | BORKJLVXJPRLLY-UHFFFAOYSA-N |
| XLogP | 12.87 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.84 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|