C54H33N7O — CID 162774812
4-[4-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-12-(3-phenylphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 162774812) has the molecular formula C54H33N7O and a molecular weight of 795.91 g/mol. Its IUPAC name is 4-[4-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-12-(3-phenylphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 4-[4-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-12-(3-phenylphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 162774812 |
| Molecular Formula | C54H33N7O |
| Molecular Weight | 795.91 g/mol |
| Exact Mass | 795.27 |
| IUPAC Name | 4-[4-[4-(4-carbazol-9-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-12-(3-phenylphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | c1ccc(-c2cccc(-c3cnc4oc5cnc(-c6ccc(-c7nc(-c8ccccc8)nc(-c8ccc(-n9c%10ccccc%10c%10ccccc%109)cc8)n7)cc6)nc5c4c3)c2)cc1 |
| InChI | InChI=1S/C54H33N7O/c1-3-12-34(13-4-1)39-16-11-17-40(30-39)41-31-45-49-48(62-54(45)56-32-41)33-55-50(57-49)36-22-24-37(25-23-36)52-58-51(35-14-5-2-6-15-35)59-53(60-52)38-26-28-42(29-27-38)61-46-20-9-7-18-43(46)44-19-8-10-21-47(44)61/h1-33H |
| InChIKey | QNRDFSGKPVDKOS-UHFFFAOYSA-N |
| XLogP | 13.06 |
| TPSA | 95.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.91 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |