C48H30N6O — CID 162775026
4-(4-phenylphenyl)-12-[4-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 162775026) has the molecular formula C48H30N6O and a molecular weight of 706.81 g/mol. Its IUPAC name is 4-(4-phenylphenyl)-12-[4-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 4-(4-phenylphenyl)-12-[4-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 162775026 |
| Molecular Formula | C48H30N6O |
| Molecular Weight | 706.81 g/mol |
| Exact Mass | 706.25 |
| IUPAC Name | 4-(4-phenylphenyl)-12-[4-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | c1ccc(-c2ccc(-c3ncc4oc5ncc(-c6ccc(-c7nc(-c8ccccc8)nc(-c8cccc(-c9ccccc9)c8)n7)cc6)cc5c4n3)cc2)cc1 |
| InChI | InChI=1S/C48H30N6O/c1-4-11-31(12-5-1)33-19-23-36(24-20-33)44-49-30-42-43(51-44)41-28-40(29-50-48(41)55-42)34-21-25-37(26-22-34)46-52-45(35-15-8-3-9-16-35)53-47(54-46)39-18-10-17-38(27-39)32-13-6-2-7-14-32/h1-30H |
| InChIKey | VWKARDKLQCMXNB-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.81 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |