C54H35N3 — CID 162776105
4-[2-(5-isocyano-9,9-diphenylfluoren-3-yl)phenyl]-2-phenyl-6-(3-phenylphenyl)pyrimidine (PubChem CID 162776105) has the molecular formula C54H35N3 and a molecular weight of 725.90 g/mol. Its IUPAC name is 4-[2-(5-isocyano-9,9-diphenylfluoren-3-yl)phenyl]-2-phenyl-6-(3-phenylphenyl)pyrimidine.
| Compound Name | 4-[2-(5-isocyano-9,9-diphenylfluoren-3-yl)phenyl]-2-phenyl-6-(3-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 162776105 |
| Molecular Formula | C54H35N3 |
| Molecular Weight | 725.90 g/mol |
| Exact Mass | 725.28 |
| IUPAC Name | 4-[2-(5-isocyano-9,9-diphenylfluoren-3-yl)phenyl]-2-phenyl-6-(3-phenylphenyl)pyrimidine |
| SMILES | [C-]#[N+]c1cccc2c1-c1cc(-c3ccccc3-c3cc(-c4cccc(-c5ccccc5)c4)nc(-c4ccccc4)n3)ccc1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H35N3/c1-55-49-31-17-30-48-52(49)46-35-40(32-33-47(46)54(48,42-24-10-4-11-25-42)43-26-12-5-13-27-43)44-28-14-15-29-45(44)51-36-50(56-53(57-51)38-20-8-3-9-21-38)41-23-16-22-39(34-41)37-18-6-2-7-19-37/h2-36H |
| InChIKey | OOPHGAARYZEIQN-UHFFFAOYSA-N |
| XLogP | 13.73 |
| TPSA | 30.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.90 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|