C50H35N3 — CID 162776196
2-[3-[4-(6-isocyano-9,9-dimethylfluoren-4-yl)phenyl]phenyl]-4-phenyl-6-(2-phenylphenyl)pyrimidine (PubChem CID 162776196) has the molecular formula C50H35N3 and a molecular weight of 677.85 g/mol. Its IUPAC name is 2-[3-[4-(6-isocyano-9,9-dimethylfluoren-4-yl)phenyl]phenyl]-4-phenyl-6-(2-phenylphenyl)pyrimidine.
| Compound Name | 2-[3-[4-(6-isocyano-9,9-dimethylfluoren-4-yl)phenyl]phenyl]-4-phenyl-6-(2-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 162776196 |
| Molecular Formula | C50H35N3 |
| Molecular Weight | 677.85 g/mol |
| Exact Mass | 677.28 |
| IUPAC Name | 2-[3-[4-(6-isocyano-9,9-dimethylfluoren-4-yl)phenyl]phenyl]-4-phenyl-6-(2-phenylphenyl)pyrimidine |
| SMILES | [C-]#[N+]c1ccc2c(c1)-c1c(-c3ccc(-c4cccc(-c5nc(-c6ccccc6)cc(-c6ccccc6-c6ccccc6)n5)c4)cc3)cccc1C2(C)C |
| InChI | InChI=1S/C50H35N3/c1-50(2)44-29-28-39(51-3)31-43(44)48-41(22-13-23-45(48)50)35-26-24-33(25-27-35)37-18-12-19-38(30-37)49-52-46(36-16-8-5-9-17-36)32-47(53-49)42-21-11-10-20-40(42)34-14-6-4-7-15-34/h4-32H,1-2H3 |
| InChIKey | KHMBDMPNBIWYFK-UHFFFAOYSA-N |
| XLogP | 13.34 |
| TPSA | 30.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.85 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|