C23H21N3O — CID 162777250
9-[4-(1,1-dideuterio-2,2-dimethylpropyl)-2-pyridinyl]-3-(trideuteriomethyl)-15-oxa-4,7-diazatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene (PubChem CID 162777250) has the molecular formula C23H21N3O and a molecular weight of 360.47 g/mol. Its IUPAC name is 9-[4-(1,1-dideuterio-2,2-dimethylpropyl)-2-pyridinyl]-3-(trideuteriomethyl)-15-oxa-4,7-diazatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene.
| Compound Name | 9-[4-(1,1-dideuterio-2,2-dimethylpropyl)-2-pyridinyl]-3-(trideuteriomethyl)-15-oxa-4,7-diazatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene |
|---|---|
| PubChem CID | 162777250 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 9-[4-(1,1-dideuterio-2,2-dimethylpropyl)-2-pyridinyl]-3-(trideuteriomethyl)-15-oxa-4,7-diazatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene |
| SMILES | [2H]C([2H])([2H])c1cc2oc3ccc(-c4cc(C([2H])([2H])C(C)(C)C)ccn4)c4ncc(n1)c2c34 |
| InChI | InChI=1S/C23H21N3O/c1-13-9-19-20-17(26-13)12-25-22-15(5-6-18(27-19)21(20)22)16-10-14(7-8-24-16)11-23(2,3)4/h5-10,12H,11H2,1-4H3/i1D3,11D2 |
| InChIKey | HUTUNDPHMKCXOV-JIZANVDTSA-N |
| XLogP | 5.93 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|