C11H9F3N2O3S — CID 162778781
2-[7-(trifluoromethyl)cinnolin-2-ium-2-yl]ethanesulfonate (PubChem CID 162778781) has the molecular formula C11H9F3N2O3S and a molecular weight of 306.27 g/mol. Its IUPAC name is 2-[7-(trifluoromethyl)cinnolin-2-ium-2-yl]ethanesulfonate.
| Compound Name | 2-[7-(trifluoromethyl)cinnolin-2-ium-2-yl]ethanesulfonate |
|---|---|
| PubChem CID | 162778781 |
| Molecular Formula | C11H9F3N2O3S |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-[7-(trifluoromethyl)cinnolin-2-ium-2-yl]ethanesulfonate |
| SMILES | O=S(=O)([O-])CC[n+]1ccc2ccc(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C11H9F3N2O3S/c12-11(13,14)9-2-1-8-3-4-16(15-10(8)7-9)5-6-20(17,18)19/h1-4,7H,5-6H2 |
| InChIKey | FJJGVIOGWYUFJZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 73.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|