C57H34N4OS — CID 162780486
9-[4-[4-(3-dibenzofuran-4-ylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-9-phenyldibenzothiophen-2-yl]carbazole (PubChem CID 162780486) has the molecular formula C57H34N4OS and a molecular weight of 828.02 g/mol. Its IUPAC name is 9-[4-[4-(3-dibenzofuran-4-ylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-9-phenyldibenzothiophen-2-yl]carbazole.
| Compound Name | 9-[4-[4-(3-dibenzofuran-4-ylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-9-phenyldibenzothiophen-2-yl]carbazole |
|---|---|
| PubChem CID | 162780486 |
| Molecular Formula | C57H34N4OS |
| Molecular Weight | 828.02 g/mol |
| Exact Mass | 827.28 |
| IUPAC Name | 9-[4-[4-(3-dibenzofuran-4-ylphenyl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-9-phenyldibenzothiophen-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3cccc(-c4cccc5c4oc4ccccc45)c3)nc(-c3cc(-n4c5ccccc5c5ccccc54)cc4c3sc3cccc(-c5ccccc5)c34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C57H34N4OS/c1-3-16-35(17-4-1)40-25-15-31-51-52(40)46-33-39(61-48-28-10-7-22-42(48)43-23-8-11-29-49(43)61)34-47(54(46)63-51)57-59-55(36-18-5-2-6-19-36)58-56(60-57)38-21-13-20-37(32-38)41-26-14-27-45-44-24-9-12-30-50(44)62-53(41)45/h1-34H/i2D,5D,6D,18D,19D |
| InChIKey | UNOPQVPVPZUTRM-GTHNAFMHSA-N |
| XLogP | 15.57 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.02 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |