C57H34N4S — CID 162780560
9-[9-(2,3,4,5,6-pentadeuteriophenyl)-4-(4-phenyl-6-triphenylen-1-yl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]carbazole (PubChem CID 162780560) has the molecular formula C57H34N4S and a molecular weight of 812.02 g/mol. Its IUPAC name is 9-[9-(2,3,4,5,6-pentadeuteriophenyl)-4-(4-phenyl-6-triphenylen-1-yl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]carbazole.
| Compound Name | 9-[9-(2,3,4,5,6-pentadeuteriophenyl)-4-(4-phenyl-6-triphenylen-1-yl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]carbazole |
|---|---|
| PubChem CID | 162780560 |
| Molecular Formula | C57H34N4S |
| Molecular Weight | 812.02 g/mol |
| Exact Mass | 811.28 |
| IUPAC Name | 9-[9-(2,3,4,5,6-pentadeuteriophenyl)-4-(4-phenyl-6-triphenylen-1-yl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3sc4c(-c5nc(-c6ccccc6)nc(-c6cccc7c8ccccc8c8ccccc8c67)n5)cc(-n5c6ccccc6c6ccccc65)cc4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C57H34N4S/c1-3-17-35(18-4-1)38-27-16-32-51-53(38)47-33-37(61-49-30-13-11-24-42(49)43-25-12-14-31-50(43)61)34-48(54(47)62-51)57-59-55(36-19-5-2-6-20-36)58-56(60-57)46-29-15-28-45-41-22-8-7-21-39(41)40-23-9-10-26-44(40)52(45)46/h1-34H/i1D,3D,4D,17D,18D |
| InChIKey | DUEGEABINSDUFC-BPEKIDLNSA-N |
| XLogP | 15.46 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.02 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|