C51H32N4S — CID 170536745
1,2,3,4,5,6,7,8-octadeuterio-9-[3-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-1-yl]-5-phenylphenyl]carbazole (PubChem CID 170536745) has the molecular formula C51H32N4S and a molecular weight of 740.96 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octadeuterio-9-[3-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-1-yl]-5-phenylphenyl]carbazole.
| Compound Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[3-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-1-yl]-5-phenylphenyl]carbazole |
|---|---|
| PubChem CID | 170536745 |
| Molecular Formula | C51H32N4S |
| Molecular Weight | 740.96 g/mol |
| Exact Mass | 740.28 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octadeuterio-9-[3-[6-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-1-yl]-5-phenylphenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1cc(-c2ccccc2)cc(-c2cccc3sc4c(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cccc4c23)c1 |
| InChI | InChI=1S/C51H32N4S/c1-4-16-33(17-5-1)36-30-37(32-38(31-36)55-44-27-12-10-22-40(44)41-23-11-13-28-45(41)55)39-24-15-29-46-47(39)42-25-14-26-43(48(42)56-46)51-53-49(34-18-6-2-7-19-34)52-50(54-51)35-20-8-3-9-21-35/h1-32H/i10D,11D,12D,13D,22D,23D,27D,28D |
| InChIKey | GRORHDZMSRVRBP-XPSONQHRSA-N |
| XLogP | 13.67 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.96 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |