C51H31N5S — CID 164847686
1,2,3,4,5,6,7,8,9,10-decadeuterio-12-(4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazin-2-yl)-11-(3-phenylphenyl)indolo[2,3-a]carbazole (PubChem CID 164847686) has the molecular formula C51H31N5S and a molecular weight of 755.97 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9,10-decadeuterio-12-(4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazin-2-yl)-11-(3-phenylphenyl)indolo[2,3-a]carbazole.
| Compound Name | 1,2,3,4,5,6,7,8,9,10-decadeuterio-12-(4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazin-2-yl)-11-(3-phenylphenyl)indolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 164847686 |
| Molecular Formula | C51H31N5S |
| Molecular Weight | 755.97 g/mol |
| Exact Mass | 755.29 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9,10-decadeuterio-12-(4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazin-2-yl)-11-(3-phenylphenyl)indolo[2,3-a]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c1c([2H])c([2H])c3c4c([2H])c([2H])c([2H])c([2H])c4n(-c4nc(-c5ccccc5)nc(-c5cccc6c5sc5ccccc56)n4)c3c1n2-c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C51H31N5S/c1-3-15-32(16-4-1)34-19-13-20-35(31-34)55-43-26-10-7-21-36(43)39-29-30-40-37-22-8-11-27-44(37)56(47(40)46(39)55)51-53-49(33-17-5-2-6-18-33)52-50(54-51)42-25-14-24-41-38-23-9-12-28-45(38)57-48(41)42/h1-31H/i7D,8D,10D,11D,21D,22D,26D,27D,29D,30D |
| InChIKey | XTNCJPSWNGLJIZ-VSGIOCOWSA-N |
| XLogP | 13.43 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.97 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |