C39H24N4S — CID 176767110
1,2,3,4,5,6,7-heptadeuterio-8-(4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazin-2-yl)-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole (PubChem CID 176767110) has the molecular formula C39H24N4S and a molecular weight of 592.79 g/mol. Its IUPAC name is 1,2,3,4,5,6,7-heptadeuterio-8-(4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazin-2-yl)-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole.
| Compound Name | 1,2,3,4,5,6,7-heptadeuterio-8-(4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazin-2-yl)-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
|---|---|
| PubChem CID | 176767110 |
| Molecular Formula | C39H24N4S |
| Molecular Weight | 592.79 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | 1,2,3,4,5,6,7-heptadeuterio-8-(4-dibenzothiophen-4-yl-6-phenyl-1,3,5-triazin-2-yl)-9-(2,3,4,5,6-pentadeuteriophenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3c([2H])c([2H])c([2H])c([2H])c3c3c([2H])c([2H])c([2H])c(-c4nc(-c5ccccc5)nc(-c5cccc6c5sc5ccccc56)n4)c32)c([2H])c1[2H] |
| InChI | InChI=1S/C39H24N4S/c1-3-13-25(14-4-1)37-40-38(42-39(41-37)32-22-12-20-30-28-18-8-10-24-34(28)44-36(30)32)31-21-11-19-29-27-17-7-9-23-33(27)43(35(29)31)26-15-5-2-6-16-26/h1-24H/i2D,5D,6D,7D,9D,11D,15D,16D,17D,19D,21D,23D |
| InChIKey | IWRFLLGDRGEXCT-GMBCZQBKSA-N |
| XLogP | 10.34 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.79 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |