C54H36N4S — CID 162780383
9-[4-[4-(9,9-dimethylfluoren-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-2-yl]carbazole (PubChem CID 162780383) has the molecular formula C54H36N4S and a molecular weight of 778.01 g/mol. Its IUPAC name is 9-[4-[4-(9,9-dimethylfluoren-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-2-yl]carbazole.
| Compound Name | 9-[4-[4-(9,9-dimethylfluoren-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-2-yl]carbazole |
|---|---|
| PubChem CID | 162780383 |
| Molecular Formula | C54H36N4S |
| Molecular Weight | 778.01 g/mol |
| Exact Mass | 777.30 |
| IUPAC Name | 9-[4-[4-(9,9-dimethylfluoren-1-yl)-6-phenyl-1,3,5-triazin-2-yl]-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzothiophen-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3sc4c(-c5nc(-c6ccccc6)nc(-c6cccc7c6C(C)(C)c6ccccc6-7)n5)cc(-n5c6ccccc6c6ccccc65)cc4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C54H36N4S/c1-54(2)44-27-12-9-21-37(44)40-25-15-26-41(49(40)54)52-55-51(34-19-7-4-8-20-34)56-53(57-52)43-32-35(58-45-28-13-10-22-38(45)39-23-11-14-29-46(39)58)31-42-48-36(33-17-5-3-6-18-33)24-16-30-47(48)59-50(42)43/h3-32H,1-2H3/i3D,5D,6D,17D,18D |
| InChIKey | PDJLNQKCLNESNX-VXHHRLFVSA-N |
| XLogP | 14.31 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.01 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |