C60H40N4S — CID 162780430
9-[4-[4-(9,9-dimethylfluoren-1-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-8-(3-phenylphenyl)dibenzothiophen-2-yl]carbazole (PubChem CID 162780430) has the molecular formula C60H40N4S and a molecular weight of 854.11 g/mol. Its IUPAC name is 9-[4-[4-(9,9-dimethylfluoren-1-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-8-(3-phenylphenyl)dibenzothiophen-2-yl]carbazole.
| Compound Name | 9-[4-[4-(9,9-dimethylfluoren-1-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-8-(3-phenylphenyl)dibenzothiophen-2-yl]carbazole |
|---|---|
| PubChem CID | 162780430 |
| Molecular Formula | C60H40N4S |
| Molecular Weight | 854.11 g/mol |
| Exact Mass | 853.33 |
| IUPAC Name | 9-[4-[4-(9,9-dimethylfluoren-1-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]-8-(3-phenylphenyl)dibenzothiophen-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3cccc4c3C(C)(C)c3ccccc3-4)nc(-c3cc(-n4c5ccccc5c5ccccc54)cc4c3sc3ccc(-c5cccc(-c6ccccc6)c5)cc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C60H40N4S/c1-60(2)51-28-12-9-23-43(51)46-26-16-27-47(55(46)60)58-61-57(38-19-7-4-8-20-38)62-59(63-58)50-36-42(64-52-29-13-10-24-44(52)45-25-11-14-30-53(45)64)35-49-48-34-41(31-32-54(48)65-56(49)50)40-22-15-21-39(33-40)37-17-5-3-6-18-37/h3-36H,1-2H3/i4D,7D,8D,19D,20D |
| InChIKey | QCDJGPLFEKTTNX-XZKHOIIZSA-N |
| XLogP | 15.98 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.11 |
| LogP ≤ 5 | 15.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |