C57H36N4S — CID 162780319
9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(2-phenylphenyl)-1,3,5-triazin-2-yl]-8-(4-phenylphenyl)dibenzothiophen-2-yl]carbazole (PubChem CID 162780319) has the molecular formula C57H36N4S and a molecular weight of 814.04 g/mol. Its IUPAC name is 9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(2-phenylphenyl)-1,3,5-triazin-2-yl]-8-(4-phenylphenyl)dibenzothiophen-2-yl]carbazole.
| Compound Name | 9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(2-phenylphenyl)-1,3,5-triazin-2-yl]-8-(4-phenylphenyl)dibenzothiophen-2-yl]carbazole |
|---|---|
| PubChem CID | 162780319 |
| Molecular Formula | C57H36N4S |
| Molecular Weight | 814.04 g/mol |
| Exact Mass | 813.30 |
| IUPAC Name | 9-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-(2-phenylphenyl)-1,3,5-triazin-2-yl]-8-(4-phenylphenyl)dibenzothiophen-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccccc3-c3ccccc3)nc(-c3cc(-n4c5ccccc5c5ccccc54)cc4c3sc3ccc(-c5ccc(-c6ccccc6)cc5)cc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C57H36N4S/c1-4-16-37(17-5-1)38-28-30-39(31-29-38)42-32-33-53-48(34-42)49-35-43(61-51-26-14-12-23-45(51)46-24-13-15-27-52(46)61)36-50(54(49)62-53)57-59-55(41-20-8-3-9-21-41)58-56(60-57)47-25-11-10-22-44(47)40-18-6-2-7-19-40/h1-36H/i3D,8D,9D,20D,21D |
| InChIKey | QFKFEJCFAVEYCY-YBWSHAMKSA-N |
| XLogP | 15.34 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.04 |
| LogP ≤ 5 | 15.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |