C49H30N4S — CID 162780781
9-[7-naphthalen-2-yl-4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophen-2-yl]carbazole (PubChem CID 162780781) has the molecular formula C49H30N4S and a molecular weight of 711.90 g/mol. Its IUPAC name is 9-[7-naphthalen-2-yl-4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophen-2-yl]carbazole.
| Compound Name | 9-[7-naphthalen-2-yl-4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophen-2-yl]carbazole |
|---|---|
| PubChem CID | 162780781 |
| Molecular Formula | C49H30N4S |
| Molecular Weight | 711.90 g/mol |
| Exact Mass | 711.25 |
| IUPAC Name | 9-[7-naphthalen-2-yl-4-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophen-2-yl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccccc3)nc(-c3cc(-n4c5ccccc5c5ccccc54)cc4c3sc3cc(-c5ccc6ccccc6c5)ccc34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C49H30N4S/c1-3-14-32(15-4-1)47-50-48(33-16-5-2-6-17-33)52-49(51-47)42-30-37(53-43-21-11-9-19-38(43)39-20-10-12-22-44(39)53)29-41-40-26-25-36(28-45(40)54-46(41)42)35-24-23-31-13-7-8-18-34(31)27-35/h1-30H/i1D,3D,4D,14D,15D |
| InChIKey | MUAOQXYJFAZYJK-PHQJSJDESA-N |
| XLogP | 13.16 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.90 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |