C30H47BN2O8S — CID 162782381
methyl (2R,3S,5R)-3-[(4-methoxyphenyl)methyl-methylsulfonylamino]-5-methyl-2-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-bicyclo[4.1.0]heptanyl]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 162782381) has the molecular formula C30H47BN2O8S and a molecular weight of 606.59 g/mol. Its IUPAC name is methyl (2R,3S,5R)-3-[(4-methoxyphenyl)methyl-methylsulfonylamino]-5-methyl-2-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-bicyclo[4.1.0]heptanyl]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | methyl (2R,3S,5R)-3-[(4-methoxyphenyl)methyl-methylsulfonylamino]-5-methyl-2-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-bicyclo[4.1.0]heptanyl]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162782381 |
| Molecular Formula | C30H47BN2O8S |
| Molecular Weight | 606.59 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | methyl (2R,3S,5R)-3-[(4-methoxyphenyl)methyl-methylsulfonylamino]-5-methyl-2-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-bicyclo[4.1.0]heptanyl]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1[C@H](C)C[C@H](N(Cc2ccc(OC)cc2)S(C)(=O)=O)[C@@H]1COC1CCC2(B3OC(C)(C)C(C)(C)O3)CC2C1 |
| InChI | InChI=1S/C30H47BN2O8S/c1-20-15-25(32(42(8,35)36)18-21-9-11-23(37-6)12-10-21)26(33(20)27(34)38-7)19-39-24-13-14-30(17-22(30)16-24)31-40-28(2,3)29(4,5)41-31/h9-12,20,22,24-26H,13-19H2,1-8H3/t20-,22?,24?,25+,26+,30?/m1/s1 |
| InChIKey | WDVSMVJZOFVHLT-JJPIRNEKSA-N |
| XLogP | 4.48 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|