C27H33F3N4O3 — CID 162782253
2,2,2-trifluoro-N-[(4-methoxyphenyl)methyl]-N-[(2R,3S,5R)-5-methyl-2-[(6-pyrimidin-2-yl-3-bicyclo[4.1.0]heptanyl)oxymethyl]pyrrolidin-3-yl]acetamide (PubChem CID 162782253) has the molecular formula C27H33F3N4O3 and a molecular weight of 518.58 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(4-methoxyphenyl)methyl]-N-[(2R,3S,5R)-5-methyl-2-[(6-pyrimidin-2-yl-3-bicyclo[4.1.0]heptanyl)oxymethyl]pyrrolidin-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(4-methoxyphenyl)methyl]-N-[(2R,3S,5R)-5-methyl-2-[(6-pyrimidin-2-yl-3-bicyclo[4.1.0]heptanyl)oxymethyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 162782253 |
| Molecular Formula | C27H33F3N4O3 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 2,2,2-trifluoro-N-[(4-methoxyphenyl)methyl]-N-[(2R,3S,5R)-5-methyl-2-[(6-pyrimidin-2-yl-3-bicyclo[4.1.0]heptanyl)oxymethyl]pyrrolidin-3-yl]acetamide |
| SMILES | COc1ccc(CN(C(=O)C(F)(F)F)[C@H]2C[C@@H](C)N[C@H]2COC2CCC3(c4ncccn4)CC3C2)cc1 |
| InChI | InChI=1S/C27H33F3N4O3/c1-17-12-23(34(25(35)27(28,29)30)15-18-4-6-20(36-2)7-5-18)22(33-17)16-37-21-8-9-26(14-19(26)13-21)24-31-10-3-11-32-24/h3-7,10-11,17,19,21-23,33H,8-9,12-16H2,1-2H3/t17-,19?,21?,22+,23+,26?/m1/s1 |
| InChIKey | XSFXDJUEKNODKR-IBELZLNCSA-N |
| XLogP | 4.02 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |