C31H36F3KN2O5 — CID 170520168
CID 170520168 (PubChem CID 170520168) has the molecular formula C31H36F3KN2O5 and a molecular weight of 612.73 g/mol.
| Compound Name | CID 170520168 |
|---|---|
| PubChem CID | 170520168 |
| Molecular Formula | C31H36F3KN2O5 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | — |
| SMILES | COc1ccc(CN(C(=O)C(F)(F)F)[C@H]2C[C@@H](C)N(C(=O)COc3ccccc3)[C@H]2CO[C@@H]2CC[C-]3C[C@H]3C2)cc1.[K+] |
| InChI | InChI=1S/C31H36F3N2O5.K/c1-20-14-27(35(30(38)31(32,33)34)17-21-8-11-24(39-2)12-9-21)28(18-40-26-13-10-22-15-23(22)16-26)36(20)29(37)19-41-25-6-4-3-5-7-25;/h3-9,11-12,20,23,26-28H,10,13-19H2,1-2H3;/q-1;+1/t20-,23+,26-,27+,28+;/m1./s1 |
| InChIKey | WAGXTIWDPJSGGF-XXGFPHRRSA-N |
| XLogP | 2.19 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|