C50H34N3OPt- — CID 162783144
2-[1-phenyl-4-[9-phenyl-2-[4-[4-(trideuteriomethyl)phenyl]-2-pyridinyl]-3,9-dihydrofluoren-3-id-4-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 162783144) has the molecular formula C50H34N3OPt- and a molecular weight of 890.94 g/mol. Its IUPAC name is 2-[1-phenyl-4-[9-phenyl-2-[4-[4-(trideuteriomethyl)phenyl]-2-pyridinyl]-3,9-dihydrofluoren-3-id-4-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[1-phenyl-4-[9-phenyl-2-[4-[4-(trideuteriomethyl)phenyl]-2-pyridinyl]-3,9-dihydrofluoren-3-id-4-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 162783144 |
| Molecular Formula | C50H34N3OPt- |
| Molecular Weight | 890.94 g/mol |
| Exact Mass | 890.25 |
| IUPAC Name | 2-[1-phenyl-4-[9-phenyl-2-[4-[4-(trideuteriomethyl)phenyl]-2-pyridinyl]-3,9-dihydrofluoren-3-id-4-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2ccnc(-c3[c-]c(-c4cccc5c4nc(-c4ccccc4O)n5-c4ccccc4)c4c(c3)C(c3ccccc3)c3ccccc3-4)c2)cc1.[Pt] |
| InChI | InChI=1S/C50H34N3O.Pt/c1-32-23-25-33(26-24-32)35-27-28-51-44(31-35)36-29-42(48-39-18-9-8-17-38(39)47(43(48)30-36)34-13-4-2-5-14-34)40-20-12-21-45-49(40)52-50(41-19-10-11-22-46(41)54)53(45)37-15-6-3-7-16-37;/h2-28,30-31,47,54H,1H3;/q-1;/i1D3; |
| InChIKey | DOHURTDJHZBQIT-NIIDSAIPSA-N |
| XLogP | 12.06 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.94 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|